C18H24O8S2Si — CID 10744121
3,3-ditert-butyl-2,4-dioxa-3-silatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-7,11-disulfonic acid (PubChem CID 10744121) has the molecular formula C18H24O8S2Si and a molecular weight of 460.60 g/mol. Its IUPAC name is 3,3-ditert-butyl-2,4-dioxa-3-silatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-7,11-disulfonic acid.
| Compound Name | 3,3-ditert-butyl-2,4-dioxa-3-silatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-7,11-disulfonic acid |
|---|---|
| PubChem CID | 10744121 |
| Molecular Formula | C18H24O8S2Si |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 3,3-ditert-butyl-2,4-dioxa-3-silatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-7,11-disulfonic acid |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)Oc2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(c23)O1 |
| InChI | InChI=1S/C18H24O8S2Si/c1-17(2,3)29(18(4,5)6)25-14-9-12(27(19,20)21)7-11-8-13(28(22,23)24)10-15(26-29)16(11)14/h7-10H,1-6H3,(H,19,20,21)(H,22,23,24) |
| InChIKey | CZZZFRVGWBHLHS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|