C40H44Br2Li2O4 — CID 10747711
CID 10747711 (PubChem CID 10747711) has the molecular formula C40H44Br2Li2O4 and a molecular weight of 762.48 g/mol.
| Compound Name | CID 10747711 |
|---|---|
| PubChem CID | 10747711 |
| Molecular Formula | C40H44Br2Li2O4 |
| Molecular Weight | 762.48 g/mol |
| Exact Mass | 760.19 |
| IUPAC Name | — |
| SMILES | CCCOc1cc2[c-]c(c1)Cc1cc(OCCC)cc(c1Br)Cc1[c-]c(cc(OCCC)c1)Cc1cc(OCCC)cc(c1Br)C2.[Li+].[Li+] |
| InChI | InChI=1S/C40H44Br2O4.2Li/c1-5-9-43-35-19-27-13-28(20-35)16-32-24-38(46-12-8-4)26-34(40(32)42)18-30-14-29(21-36(22-30)44-10-6-2)17-33-25-37(45-11-7-3)23-31(15-27)39(33)41;;/h19-26H,5-12,15-18H2,1-4H3;;/q-2;2*+1 |
| InChIKey | ILUHJCCPKDLOOZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|