C8H13F3N4OS — CID 107486372
2-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-(2,2,2-trifluoroethyl)amino]ethanol (PubChem CID 107486372) has the molecular formula C8H13F3N4OS and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-(2,2,2-trifluoroethyl)amino]ethanol.
| Compound Name | 2-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-(2,2,2-trifluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107486372 |
| Molecular Formula | C8H13F3N4OS |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-(2,2,2-trifluoroethyl)amino]ethanol |
| SMILES | NNc1ncc(CN(CCO)CC(F)(F)F)s1 |
| InChI | InChI=1S/C8H13F3N4OS/c9-8(10,11)5-15(1-2-16)4-6-3-13-7(14-12)17-6/h3,16H,1-2,4-5,12H2,(H,13,14) |
| InChIKey | OTAGGXGLYZOEQJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|