C8H15N5OS — CID 103104146
2-[ethyl-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]amino]acetamide (PubChem CID 103104146) has the molecular formula C8H15N5OS and a molecular weight of 229.31 g/mol. Its IUPAC name is 2-[ethyl-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]amino]acetamide.
| Compound Name | 2-[ethyl-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 103104146 |
| Molecular Formula | C8H15N5OS |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-[ethyl-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]amino]acetamide |
| SMILES | CCN(CC(N)=O)Cc1cnc(NN)s1 |
| InChI | InChI=1S/C8H15N5OS/c1-2-13(5-7(9)14)4-6-3-11-8(12-10)15-6/h3H,2,4-5,10H2,1H3,(H2,9,14)(H,11,12) |
| InChIKey | HBFIOEQHSQWVST-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|