C8H16N4S — CID 79765675
N-ethyl-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]ethanamine (PubChem CID 79765675) has the molecular formula C8H16N4S and a molecular weight of 200.31 g/mol. Its IUPAC name is N-ethyl-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]ethanamine.
| Compound Name | N-ethyl-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 79765675 |
| Molecular Formula | C8H16N4S |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | N-ethyl-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]ethanamine |
| SMILES | CCN(CC)Cc1cnc(NN)s1 |
| InChI | InChI=1S/C8H16N4S/c1-3-12(4-2)6-7-5-10-8(11-9)13-7/h5H,3-4,6,9H2,1-2H3,(H,10,11) |
| InChIKey | XEBRLECLDPBKKG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|