C10H20N4S — CID 79765022
N-ethyl-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-2-methylpropan-1-amine (PubChem CID 79765022) has the molecular formula C10H20N4S and a molecular weight of 228.36 g/mol. Its IUPAC name is N-ethyl-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-2-methylpropan-1-amine.
| Compound Name | N-ethyl-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 79765022 |
| Molecular Formula | C10H20N4S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | N-ethyl-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-2-methylpropan-1-amine |
| SMILES | CCN(Cc1cnc(NN)s1)CC(C)C |
| InChI | InChI=1S/C10H20N4S/c1-4-14(6-8(2)3)7-9-5-12-10(13-11)15-9/h5,8H,4,6-7,11H2,1-3H3,(H,12,13) |
| InChIKey | YSMUDWQJMRNNGA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|