C9H17N3S2 — CID 107756782
[5-(3-methylbutylsulfanylmethyl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 107756782) has the molecular formula C9H17N3S2 and a molecular weight of 231.39 g/mol. Its IUPAC name is [5-(3-methylbutylsulfanylmethyl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-(3-methylbutylsulfanylmethyl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 107756782 |
| Molecular Formula | C9H17N3S2 |
| Molecular Weight | 231.39 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | [5-(3-methylbutylsulfanylmethyl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | CC(C)CCSCc1cnc(NN)s1 |
| InChI | InChI=1S/C9H17N3S2/c1-7(2)3-4-13-6-8-5-11-9(12-10)14-8/h5,7H,3-4,6,10H2,1-2H3,(H,11,12) |
| InChIKey | JBLFIJSFGJIVJN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|