C15H16ClNOS — CID 107504561
2-(2-chlorophenyl)sulfanyl-1-(2,6-dimethyl-4-pyridinyl)ethanol (PubChem CID 107504561) has the molecular formula C15H16ClNOS and a molecular weight of 293.82 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-1-(2,6-dimethyl-4-pyridinyl)ethanol.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-1-(2,6-dimethyl-4-pyridinyl)ethanol |
|---|---|
| PubChem CID | 107504561 |
| Molecular Formula | C15H16ClNOS |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-1-(2,6-dimethyl-4-pyridinyl)ethanol |
| SMILES | Cc1cc(C(O)CSc2ccccc2Cl)cc(C)n1 |
| InChI | InChI=1S/C15H16ClNOS/c1-10-7-12(8-11(2)17-10)14(18)9-19-15-6-4-3-5-13(15)16/h3-8,14,18H,9H2,1-2H3 |
| InChIKey | CHGKWPAFFVOQGD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |