C14H21NO3 — CID 10753249
[(E,3R,4R)-2,4-dimethyl-7-oxo-7-(prop-2-ynylamino)hept-5-en-3-yl] acetate (PubChem CID 10753249) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is [(E,3R,4R)-2,4-dimethyl-7-oxo-7-(prop-2-ynylamino)hept-5-en-3-yl] acetate.
| Compound Name | [(E,3R,4R)-2,4-dimethyl-7-oxo-7-(prop-2-ynylamino)hept-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 10753249 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | [(E,3R,4R)-2,4-dimethyl-7-oxo-7-(prop-2-ynylamino)hept-5-en-3-yl] acetate |
| SMILES | C#CCNC(=O)/C=C/[C@@H](C)[C@H](OC(C)=O)C(C)C |
| InChI | InChI=1S/C14H21NO3/c1-6-9-15-13(17)8-7-11(4)14(10(2)3)18-12(5)16/h1,7-8,10-11,14H,9H2,2-5H3,(H,15,17)/b8-7+/t11-,14-/m1/s1 |
| InChIKey | OXMXLXOJQVYRRL-OZBKYDQSSA-N |
| XLogP | 1.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|