C14H26N2O3 — CID 155208468
[(E,3R,4R)-7-(ethylamino)-2,4-dimethyl-7-oxohept-5-en-3-yl] (2R)-2-aminopropanoate (PubChem CID 155208468) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is [(E,3R,4R)-7-(ethylamino)-2,4-dimethyl-7-oxohept-5-en-3-yl] (2R)-2-aminopropanoate.
| Compound Name | [(E,3R,4R)-7-(ethylamino)-2,4-dimethyl-7-oxohept-5-en-3-yl] (2R)-2-aminopropanoate |
|---|---|
| PubChem CID | 155208468 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | [(E,3R,4R)-7-(ethylamino)-2,4-dimethyl-7-oxohept-5-en-3-yl] (2R)-2-aminopropanoate |
| SMILES | CCNC(=O)/C=C/[C@@H](C)[C@H](OC(=O)[C@@H](C)N)C(C)C |
| InChI | InChI=1S/C14H26N2O3/c1-6-16-12(17)8-7-10(4)13(9(2)3)19-14(18)11(5)15/h7-11,13H,6,15H2,1-5H3,(H,16,17)/b8-7+/t10-,11-,13-/m1/s1 |
| InChIKey | QVXGNVLHMJNFGN-ABIQNDEVSA-N |
| XLogP | 1.23 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|