C14H14BrF2N3O — CID 107537223
3-(2-bromo-3,4-difluorophenyl)-5-(2-methylpiperidin-2-yl)-1,2,4-oxadiazole (PubChem CID 107537223) has the molecular formula C14H14BrF2N3O and a molecular weight of 358.19 g/mol. Its IUPAC name is 3-(2-bromo-3,4-difluorophenyl)-5-(2-methylpiperidin-2-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(2-bromo-3,4-difluorophenyl)-5-(2-methylpiperidin-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 107537223 |
| Molecular Formula | C14H14BrF2N3O |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 3-(2-bromo-3,4-difluorophenyl)-5-(2-methylpiperidin-2-yl)-1,2,4-oxadiazole |
| SMILES | CC1(c2nc(-c3ccc(F)c(F)c3Br)no2)CCCCN1 |
| InChI | InChI=1S/C14H14BrF2N3O/c1-14(6-2-3-7-18-14)13-19-12(20-21-13)8-4-5-9(16)11(17)10(8)15/h4-5,18H,2-3,6-7H2,1H3 |
| InChIKey | MOIBXBYWTQBCKE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|