C11H13BrF2O2 — CID 107538296
1-(2-bromo-3,4-difluorophenyl)-2-propoxyethanol (PubChem CID 107538296) has the molecular formula C11H13BrF2O2 and a molecular weight of 295.12 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-2-propoxyethanol.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-2-propoxyethanol |
|---|---|
| PubChem CID | 107538296 |
| Molecular Formula | C11H13BrF2O2 |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-2-propoxyethanol |
| SMILES | CCCOCC(O)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C11H13BrF2O2/c1-2-5-16-6-9(15)7-3-4-8(13)11(14)10(7)12/h3-4,9,15H,2,5-6H2,1H3 |
| InChIKey | ASNPFWVFTZAQPJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|