C18H34OSi — CID 10756251
[(1R,3aS,5Z,9aS)-1,5,8,8-tetramethyl-2,3,4,7,9,9a-hexahydro-1H-cyclopenta[8]annulen-3a-yl]oxy-trimethylsilane (PubChem CID 10756251) has the molecular formula C18H34OSi and a molecular weight of 294.56 g/mol. Its IUPAC name is [(1R,3aS,5Z,9aS)-1,5,8,8-tetramethyl-2,3,4,7,9,9a-hexahydro-1H-cyclopenta[8]annulen-3a-yl]oxy-trimethylsilane.
| Compound Name | [(1R,3aS,5Z,9aS)-1,5,8,8-tetramethyl-2,3,4,7,9,9a-hexahydro-1H-cyclopenta[8]annulen-3a-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10756251 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | [(1R,3aS,5Z,9aS)-1,5,8,8-tetramethyl-2,3,4,7,9,9a-hexahydro-1H-cyclopenta[8]annulen-3a-yl]oxy-trimethylsilane |
| SMILES | C/C1=C/CC(C)(C)C[C@H]2[C@H](C)CC[C@]2(O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C18H34OSi/c1-14-8-10-17(3,4)13-16-15(2)9-11-18(16,12-14)19-20(5,6)7/h8,15-16H,9-13H2,1-7H3/b14-8-/t15-,16+,18+/m1/s1 |
| InChIKey | GYEQQCLHQGVHPA-LGBMLLEHSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|