C20H38OSi — CID 10805819
[(1R,2S,3R)-2-(2,2-dimethylpent-4-enyl)-3-methyl-1-(2-methylprop-2-enyl)cyclopentyl]oxy-trimethylsilane (PubChem CID 10805819) has the molecular formula C20H38OSi and a molecular weight of 322.61 g/mol. Its IUPAC name is [(1R,2S,3R)-2-(2,2-dimethylpent-4-enyl)-3-methyl-1-(2-methylprop-2-enyl)cyclopentyl]oxy-trimethylsilane.
| Compound Name | [(1R,2S,3R)-2-(2,2-dimethylpent-4-enyl)-3-methyl-1-(2-methylprop-2-enyl)cyclopentyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10805819 |
| Molecular Formula | C20H38OSi |
| Molecular Weight | 322.61 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | [(1R,2S,3R)-2-(2,2-dimethylpent-4-enyl)-3-methyl-1-(2-methylprop-2-enyl)cyclopentyl]oxy-trimethylsilane |
| SMILES | C=CCC(C)(C)C[C@H]1[C@H](C)CC[C@]1(CC(=C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H38OSi/c1-10-12-19(5,6)15-18-17(4)11-13-20(18,14-16(2)3)21-22(7,8)9/h10,17-18H,1-2,11-15H2,3-9H3/t17-,18+,20-/m1/s1 |
| InChIKey | YLCVLBHRGYPGER-WSTZPKSXSA-N |
| XLogP | 6.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.61 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|