C13H18BrN — CID 107571985
4-bromo-3,5-dimethyl-N-(3-methylcyclobutyl)aniline (PubChem CID 107571985) has the molecular formula C13H18BrN and a molecular weight of 268.20 g/mol. Its IUPAC name is 4-bromo-3,5-dimethyl-N-(3-methylcyclobutyl)aniline.
| Compound Name | 4-bromo-3,5-dimethyl-N-(3-methylcyclobutyl)aniline |
|---|---|
| PubChem CID | 107571985 |
| Molecular Formula | C13H18BrN |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-bromo-3,5-dimethyl-N-(3-methylcyclobutyl)aniline |
| SMILES | Cc1cc(NC2CC(C)C2)cc(C)c1Br |
| InChI | InChI=1S/C13H18BrN/c1-8-4-11(5-8)15-12-6-9(2)13(14)10(3)7-12/h6-8,11,15H,4-5H2,1-3H3 |
| InChIKey | CYDGLSSWDBDUOD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |