C11H15Br2NS — CID 107597741
2,6-dibromo-N-(3-ethylsulfanylpropyl)aniline (PubChem CID 107597741) has the molecular formula C11H15Br2NS and a molecular weight of 353.12 g/mol. Its IUPAC name is 2,6-dibromo-N-(3-ethylsulfanylpropyl)aniline.
| Compound Name | 2,6-dibromo-N-(3-ethylsulfanylpropyl)aniline |
|---|---|
| PubChem CID | 107597741 |
| Molecular Formula | C11H15Br2NS |
| Molecular Weight | 353.12 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | 2,6-dibromo-N-(3-ethylsulfanylpropyl)aniline |
| SMILES | CCSCCCNc1c(Br)cccc1Br |
| InChI | InChI=1S/C11H15Br2NS/c1-2-15-8-4-7-14-11-9(12)5-3-6-10(11)13/h3,5-6,14H,2,4,7-8H2,1H3 |
| InChIKey | PFJQSRZLYJFDGZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.12 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|