C12H19NO2S2 — CID 116503779
N-(3-ethylsulfanylpropyl)-2-methylsulfonylaniline (PubChem CID 116503779) has the molecular formula C12H19NO2S2 and a molecular weight of 273.42 g/mol. Its IUPAC name is N-(3-ethylsulfanylpropyl)-2-methylsulfonylaniline.
| Compound Name | N-(3-ethylsulfanylpropyl)-2-methylsulfonylaniline |
|---|---|
| PubChem CID | 116503779 |
| Molecular Formula | C12H19NO2S2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-(3-ethylsulfanylpropyl)-2-methylsulfonylaniline |
| SMILES | CCSCCCNc1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C12H19NO2S2/c1-3-16-10-6-9-13-11-7-4-5-8-12(11)17(2,14)15/h4-5,7-8,13H,3,6,9-10H2,1-2H3 |
| InChIKey | JXYIOECQDMKUIU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|