C14H18ClIN2O3 — CID 107605756
3-[(2-chloro-4-iodophenyl)carbamoylamino]-2,2,3-trimethylbutanoic acid (PubChem CID 107605756) has the molecular formula C14H18ClIN2O3 and a molecular weight of 424.67 g/mol. Its IUPAC name is 3-[(2-chloro-4-iodophenyl)carbamoylamino]-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-[(2-chloro-4-iodophenyl)carbamoylamino]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 107605756 |
| Molecular Formula | C14H18ClIN2O3 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 3-[(2-chloro-4-iodophenyl)carbamoylamino]-2,2,3-trimethylbutanoic acid |
| SMILES | CC(C)(NC(=O)Nc1ccc(I)cc1Cl)C(C)(C)C(=O)O |
| InChI | InChI=1S/C14H18ClIN2O3/c1-13(2,11(19)20)14(3,4)18-12(21)17-10-6-5-8(16)7-9(10)15/h5-7H,1-4H3,(H,19,20)(H2,17,18,21) |
| InChIKey | GFNRZCLBJHHRQW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|