C11H10BrF2N5O — CID 107611622
1-(2-aminoethyl)-N-(4-bromo-2,5-difluorophenyl)triazole-4-carboxamide (PubChem CID 107611622) has the molecular formula C11H10BrF2N5O and a molecular weight of 346.14 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-(4-bromo-2,5-difluorophenyl)triazole-4-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-(4-bromo-2,5-difluorophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 107611622 |
| Molecular Formula | C11H10BrF2N5O |
| Molecular Weight | 346.14 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 1-(2-aminoethyl)-N-(4-bromo-2,5-difluorophenyl)triazole-4-carboxamide |
| SMILES | NCCn1cc(C(=O)Nc2cc(F)c(Br)cc2F)nn1 |
| InChI | InChI=1S/C11H10BrF2N5O/c12-6-3-8(14)9(4-7(6)13)16-11(20)10-5-19(2-1-15)18-17-10/h3-5H,1-2,15H2,(H,16,20) |
| InChIKey | XIZLHRTTWJUNHZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.14 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|