C20H38OSi3 — CID 10762233
trimethyl-[(E)-3-trimethylsilyl-4-(3-trimethylsilyloxycyclohept-2-en-1-yl)but-3-en-1-ynyl]silane (PubChem CID 10762233) has the molecular formula C20H38OSi3 and a molecular weight of 378.78 g/mol. Its IUPAC name is trimethyl-[(E)-3-trimethylsilyl-4-(3-trimethylsilyloxycyclohept-2-en-1-yl)but-3-en-1-ynyl]silane.
| Compound Name | trimethyl-[(E)-3-trimethylsilyl-4-(3-trimethylsilyloxycyclohept-2-en-1-yl)but-3-en-1-ynyl]silane |
|---|---|
| PubChem CID | 10762233 |
| Molecular Formula | C20H38OSi3 |
| Molecular Weight | 378.78 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | trimethyl-[(E)-3-trimethylsilyl-4-(3-trimethylsilyloxycyclohept-2-en-1-yl)but-3-en-1-ynyl]silane |
| SMILES | C[Si](C)(C)C#C/C(=C\C1C=C(O[Si](C)(C)C)CCCC1)[Si](C)(C)C |
| InChI | InChI=1S/C20H38OSi3/c1-22(2,3)15-14-20(23(4,5)6)17-18-12-10-11-13-19(16-18)21-24(7,8)9/h16-18H,10-13H2,1-9H3/b20-17+ |
| InChIKey | HMSOVVRGBHJONL-LVZFUZTISA-N |
| XLogP | 6.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.78 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|