C21H30OSi2 — CID 10618142
trimethyl-[3-[(E)-4-phenyl-2-trimethylsilylbut-1-en-3-ynyl]cyclopenten-1-yl]oxysilane (PubChem CID 10618142) has the molecular formula C21H30OSi2 and a molecular weight of 354.64 g/mol. Its IUPAC name is trimethyl-[3-[(E)-4-phenyl-2-trimethylsilylbut-1-en-3-ynyl]cyclopenten-1-yl]oxysilane.
| Compound Name | trimethyl-[3-[(E)-4-phenyl-2-trimethylsilylbut-1-en-3-ynyl]cyclopenten-1-yl]oxysilane |
|---|---|
| PubChem CID | 10618142 |
| Molecular Formula | C21H30OSi2 |
| Molecular Weight | 354.64 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | trimethyl-[3-[(E)-4-phenyl-2-trimethylsilylbut-1-en-3-ynyl]cyclopenten-1-yl]oxysilane |
| SMILES | C[Si](C)(C)OC1=CC(/C=C(\C#Cc2ccccc2)[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C21H30OSi2/c1-23(2,3)21(15-13-18-10-8-7-9-11-18)17-19-12-14-20(16-19)22-24(4,5)6/h7-11,16-17,19H,12,14H2,1-6H3/b21-17+ |
| InChIKey | RWQDDUKDHFPVTC-HEHNFIMWSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.64 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|