C19H34O6Si — CID 10762761
[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate (PubChem CID 10762761) has the molecular formula C19H34O6Si and a molecular weight of 386.56 g/mol. Its IUPAC name is [(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate.
| Compound Name | [(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate |
|---|---|
| PubChem CID | 10762761 |
| Molecular Formula | C19H34O6Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | [(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate |
| SMILES | CCCCCC(=O)OC[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)C1=CC(=O)OC1 |
| InChI | InChI=1S/C19H34O6Si/c1-7-8-9-10-16(21)24-13-15(20)18(14-11-17(22)23-12-14)25-26(5,6)19(2,3)4/h11,15,18,20H,7-10,12-13H2,1-6H3/t15-,18-/m1/s1 |
| InChIKey | SPNVUBMKUNPPMV-CRAIPNDOSA-N |
| XLogP | 3.34 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|