C17H34O5Si — CID 123761131
ethyl (4S,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-2-methyloct-2-enoate (PubChem CID 123761131) has the molecular formula C17H34O5Si and a molecular weight of 346.54 g/mol. Its IUPAC name is ethyl (4S,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-2-methyloct-2-enoate.
| Compound Name | ethyl (4S,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-2-methyloct-2-enoate |
|---|---|
| PubChem CID | 123761131 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | ethyl (4S,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-2-methyloct-2-enoate |
| SMILES | CCOC(=O)C(C)=C[C@H](O)[C@@H](O)C[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O5Si/c1-9-21-16(20)12(2)10-14(18)15(19)11-13(3)22-23(7,8)17(4,5)6/h10,13-15,18-19H,9,11H2,1-8H3/t13-,14-,15-/m0/s1 |
| InChIKey | JQJMGEGPTBIHOC-KKUMJFAQSA-N |
| XLogP | 3.02 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|