C21H30N2O5 — CID 10762986
[(E)-but-2-enyl] 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoyl]amino]acetate (PubChem CID 10762986) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is [(E)-but-2-enyl] 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoyl]amino]acetate.
| Compound Name | [(E)-but-2-enyl] 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoyl]amino]acetate |
|---|---|
| PubChem CID | 10762986 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [(E)-but-2-enyl] 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoyl]amino]acetate |
| SMILES | C/C=C/COC(=O)CNC(=O)[C@H](CCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H30N2O5/c1-5-6-14-27-18(24)15-22-19(25)17(23-20(26)28-21(2,3)4)13-12-16-10-8-7-9-11-16/h5-11,17H,12-15H2,1-4H3,(H,22,25)(H,23,26)/b6-5+/t17-/m0/s1 |
| InChIKey | JBHQHSWHQRTPTA-RTRPANQVSA-N |
| XLogP | 2.75 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|