C17H19F3N2O4 — CID 23242159
[(E)-but-2-enyl] 2-[[3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetate (PubChem CID 23242159) has the molecular formula C17H19F3N2O4 and a molecular weight of 372.34 g/mol. Its IUPAC name is [(E)-but-2-enyl] 2-[[3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetate.
| Compound Name | [(E)-but-2-enyl] 2-[[3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetate |
|---|---|
| PubChem CID | 23242159 |
| Molecular Formula | C17H19F3N2O4 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [(E)-but-2-enyl] 2-[[3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetate |
| SMILES | C/C=C/COC(=O)CNC(=O)C(Cc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H19F3N2O4/c1-2-3-9-26-14(23)11-21-15(24)13(22-16(25)17(18,19)20)10-12-7-5-4-6-8-12/h2-8,13H,9-11H2,1H3,(H,21,24)(H,22,25)/b3-2+ |
| InChIKey | HDILJVUHLQBVLK-NSCUHMNNSA-N |
| XLogP | 1.51 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|