C19H20O5S2 — CID 10763101
(4R)-4-[(2R,3R)-3-(benzenesulfonyl)-3-phenylsulfanyloxiran-2-yl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10763101) has the molecular formula C19H20O5S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is (4R)-4-[(2R,3R)-3-(benzenesulfonyl)-3-phenylsulfanyloxiran-2-yl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-[(2R,3R)-3-(benzenesulfonyl)-3-phenylsulfanyloxiran-2-yl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10763101 |
| Molecular Formula | C19H20O5S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (4R)-4-[(2R,3R)-3-(benzenesulfonyl)-3-phenylsulfanyloxiran-2-yl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OC[C@H]([C@H]2O[C@]2(Sc2ccccc2)S(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C19H20O5S2/c1-18(2)22-13-16(23-18)17-19(24-17,25-14-9-5-3-6-10-14)26(20,21)15-11-7-4-8-12-15/h3-12,16-17H,13H2,1-2H3/t16-,17-,19-/m1/s1 |
| InChIKey | MDUQPZFYPOESAT-ZHALLVOQSA-N |
| XLogP | 3.46 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|