C25H28N2O4 — CID 10764612
N-[3-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]propyl]-3-oxobutanamide (PubChem CID 10764612) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-[3-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]propyl]-3-oxobutanamide.
| Compound Name | N-[3-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]propyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 10764612 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-[3-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]propyl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NCCCNC1=C(C(C)=O)CC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C25H28N2O4/c1-18(28)16-23(30)26-14-9-15-27-24-22(19(2)29)17-25(31-24,20-10-5-3-6-11-20)21-12-7-4-8-13-21/h3-8,10-13,27H,9,14-17H2,1-2H3,(H,26,30) |
| InChIKey | IIFSDMSLXZZOAT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|