About 6-cyclopropyl-5-methylimidazo[2,1-b][1,3,4]thiadiazole
6-cyclopropyl-5-methylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 107646795) has the molecular formula C8H9N3S
and a molecular weight of 179.25 g/mol. Its IUPAC name is 6-cyclopropyl-5-methylimidazo[2,1-b][1,3,4]thiadiazole.
Analyze 6-cyclopropyl-5-methylimidazo[2,1-b][1,3,4]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyl-5-methylimidazo[2,1-b][1,3,4]thiadiazole?
The IUPAC name of 6-cyclopropyl-5-methylimidazo[2,1-b][1,3,4]thiadiazole (CID 107646795) is 6-cyclopropyl-5-methylimidazo[2,1-b][1,3,4]thiadiazole.
What is the SMILES notation for 6-cyclopropyl-5-methylimidazo[2,1-b][1,3,4]thiadiazole?
The canonical SMILES for 6-cyclopropyl-5-methylimidazo[2,1-b][1,3,4]thiadiazole is Cc1c(C2CC2)nc2scnn12.
What is the InChIKey of 6-cyclopropyl-5-methylimidazo[2,1-b][1,3,4]thiadiazole?
The InChIKey is QPFLLIOXYMZEMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S/c1-5-7(6-2-3-6)10-8-11(5)9-4-12-8/h4,6H,2-3H2,1H3.
What are the key properties of 6-cyclopropyl-5-methylimidazo[2,1-b][1,3,4]thiadiazole?
6-cyclopropyl-5-methylimidazo[2,1-b][1,3,4]thiadiazole has a molecular weight of 179.25 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyl-5-methylimidazo[2,1-b][1,3,4]thiadiazole is sourced from PubChem (CID 107646795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).