C10H13N3S — CID 107646813
6,8-dimethyl-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,2-a]benzimidazole (PubChem CID 107646813) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 6,8-dimethyl-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,2-a]benzimidazole.
| Compound Name | 6,8-dimethyl-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,2-a]benzimidazole |
|---|---|
| PubChem CID | 107646813 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 6,8-dimethyl-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,2-a]benzimidazole |
| SMILES | CC1Cc2nc3scnn3c2C(C)C1 |
| InChI | InChI=1S/C10H13N3S/c1-6-3-7(2)9-8(4-6)12-10-13(9)11-5-14-10/h5-7H,3-4H2,1-2H3 |
| InChIKey | ZLUSOICKMREYBJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |