C21H16N2O2SSe — CID 10765556
7-deuterio-7-phenylselanyl-12H-benzimidazolo[2,1-c][2,4]benzothiazepine 6,6-dioxide (PubChem CID 10765556) has the molecular formula C21H16N2O2SSe and a molecular weight of 440.40 g/mol. Its IUPAC name is 7-deuterio-7-phenylselanyl-12H-benzimidazolo[2,1-c][2,4]benzothiazepine 6,6-dioxide.
| Compound Name | 7-deuterio-7-phenylselanyl-12H-benzimidazolo[2,1-c][2,4]benzothiazepine 6,6-dioxide |
|---|---|
| PubChem CID | 10765556 |
| Molecular Formula | C21H16N2O2SSe |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 7-deuterio-7-phenylselanyl-12H-benzimidazolo[2,1-c][2,4]benzothiazepine 6,6-dioxide |
| SMILES | [2H]C1([Se]c2ccccc2)c2ccccc2Cn2c(nc3ccccc32)S1(=O)=O |
| InChI | InChI=1S/C21H16N2O2SSe/c24-26(25)20(27-16-9-2-1-3-10-16)17-11-5-4-8-15(17)14-23-19-13-7-6-12-18(19)22-21(23)26/h1-13,20H,14H2/i20D |
| InChIKey | MSIMLINRDIXRQX-YVHRXSIGSA-N |
| XLogP | 2.90 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|