C29H50OS — CID 10765813
2,2-dimethyl-3-[(E)-3-methyl-7-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]sulfanyloct-3-enyl]oxirane (PubChem CID 10765813) has the molecular formula C29H50OS and a molecular weight of 446.79 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(E)-3-methyl-7-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]sulfanyloct-3-enyl]oxirane.
| Compound Name | 2,2-dimethyl-3-[(E)-3-methyl-7-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]sulfanyloct-3-enyl]oxirane |
|---|---|
| PubChem CID | 10765813 |
| Molecular Formula | C29H50OS |
| Molecular Weight | 446.79 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | 2,2-dimethyl-3-[(E)-3-methyl-7-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]sulfanyloct-3-enyl]oxirane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCSC(C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C29H50OS/c1-23(2)13-9-14-24(3)15-10-16-25(4)18-12-22-31-27(6)19-11-17-26(5)20-21-28-29(7,8)30-28/h13,15,17-18,27-28H,9-12,14,16,19-22H2,1-8H3/b24-15+,25-18+,26-17+ |
| InChIKey | GEVBRBRQHZECDC-VPTOSAMDSA-N |
| XLogP | 9.60 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.79 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|