C25H39NO5S — CID 10766608
(2R,3S,4S,6R)-2-ethyl-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-4,6-dimethyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]heptan-1-one (PubChem CID 10766608) has the molecular formula C25H39NO5S and a molecular weight of 465.66 g/mol. Its IUPAC name is (2R,3S,4S,6R)-2-ethyl-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-4,6-dimethyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]heptan-1-one.
| Compound Name | (2R,3S,4S,6R)-2-ethyl-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-4,6-dimethyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]heptan-1-one |
|---|---|
| PubChem CID | 10766608 |
| Molecular Formula | C25H39NO5S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | (2R,3S,4S,6R)-2-ethyl-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-4,6-dimethyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]heptan-1-one |
| SMILES | CC[C@@H](C(=O)N1C(=S)OC[C@@H]1C(C)C)[C@@H](O)[C@@H](C)C[C@@H](C)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H39NO5S/c1-7-21(24(28)26-22(16(2)3)15-31-25(26)32)23(27)18(5)12-17(4)13-30-14-19-8-10-20(29-6)11-9-19/h8-11,16-18,21-23,27H,7,12-15H2,1-6H3/t17-,18+,21-,22-,23+/m1/s1 |
| InChIKey | TVNWWQUAHUHZOE-DDFUWSPLSA-N |
| XLogP | 4.43 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|