C21H32Cl3NO7S — CID 10768989
[(2R)-2-hydroxy-3-[6-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonylamino]hexoxy]propyl] 4-methylbenzenesulfonate (PubChem CID 10768989) has the molecular formula C21H32Cl3NO7S and a molecular weight of 548.91 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-[6-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonylamino]hexoxy]propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-2-hydroxy-3-[6-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonylamino]hexoxy]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10768989 |
| Molecular Formula | C21H32Cl3NO7S |
| Molecular Weight | 548.91 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | [(2R)-2-hydroxy-3-[6-[(1,1,1-trichloro-2-methylpropan-2-yl)oxycarbonylamino]hexoxy]propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](O)COCCCCCCNC(=O)OC(C)(C)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C21H32Cl3NO7S/c1-16-8-10-18(11-9-16)33(28,29)31-15-17(26)14-30-13-7-5-4-6-12-25-19(27)32-20(2,3)21(22,23)24/h8-11,17,26H,4-7,12-15H2,1-3H3,(H,25,27)/t17-/m1/s1 |
| InChIKey | ZSAPFJRSTQNBOB-QGZVFWFLSA-N |
| XLogP | 4.51 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.91 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|