C30H35N3O7 — CID 10768996
tert-butyl 2-[4-[[5-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]-1-benzofuran-2-carbonyl]amino]cyclohexyl]oxyacetate (PubChem CID 10768996) has the molecular formula C30H35N3O7 and a molecular weight of 549.62 g/mol. Its IUPAC name is tert-butyl 2-[4-[[5-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]-1-benzofuran-2-carbonyl]amino]cyclohexyl]oxyacetate.
| Compound Name | tert-butyl 2-[4-[[5-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]-1-benzofuran-2-carbonyl]amino]cyclohexyl]oxyacetate |
|---|---|
| PubChem CID | 10768996 |
| Molecular Formula | C30H35N3O7 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | tert-butyl 2-[4-[[5-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]-1-benzofuran-2-carbonyl]amino]cyclohexyl]oxyacetate |
| SMILES | CC(C)(C)OC(=O)COC1CCC(NC(=O)c2cc3cc(/C(N)=N\C(=O)OCc4ccccc4)ccc3o2)CC1 |
| InChI | InChI=1S/C30H35N3O7/c1-30(2,3)40-26(34)18-37-23-12-10-22(11-13-23)32-28(35)25-16-21-15-20(9-14-24(21)39-25)27(31)33-29(36)38-17-19-7-5-4-6-8-19/h4-9,14-16,22-23H,10-13,17-18H2,1-3H3,(H,32,35)(H2,31,33,36) |
| InChIKey | PTORCDQKZHRYEI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|