C30H27F3N4O8S — CID 162540849
ethyl (2S)-3-[4-[[5-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]-1-benzofuran-2-carbonyl]amino]phenyl]-2-(trifluoromethylsulfonylamino)propanoate (PubChem CID 162540849) has the molecular formula C30H27F3N4O8S and a molecular weight of 660.63 g/mol. Its IUPAC name is ethyl (2S)-3-[4-[[5-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]-1-benzofuran-2-carbonyl]amino]phenyl]-2-(trifluoromethylsulfonylamino)propanoate.
| Compound Name | ethyl (2S)-3-[4-[[5-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]-1-benzofuran-2-carbonyl]amino]phenyl]-2-(trifluoromethylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 162540849 |
| Molecular Formula | C30H27F3N4O8S |
| Molecular Weight | 660.63 g/mol |
| Exact Mass | 660.15 |
| IUPAC Name | ethyl (2S)-3-[4-[[5-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]-1-benzofuran-2-carbonyl]amino]phenyl]-2-(trifluoromethylsulfonylamino)propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(NC(=O)c2cc3cc(/C(N)=N/C(=O)OCc4ccccc4)ccc3o2)cc1)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C30H27F3N4O8S/c1-2-43-28(39)23(37-46(41,42)30(31,32)33)14-18-8-11-22(12-9-18)35-27(38)25-16-21-15-20(10-13-24(21)45-25)26(34)36-29(40)44-17-19-6-4-3-5-7-19/h3-13,15-16,23,37H,2,14,17H2,1H3,(H,35,38)(H2,34,36,40)/t23-/m0/s1 |
| InChIKey | YYLQBNVZJAIGJE-QHCPKHFHSA-N |
| XLogP | 4.64 |
| TPSA | 179.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|