C26H27N3O7 — CID 173320191
[5-(N'-phenylmethoxycarbonylcarbamimidoyl)-1-benzofuran-2-yl] 2-cyclohexyloxy-2-formamidoacetate (PubChem CID 173320191) has the molecular formula C26H27N3O7 and a molecular weight of 493.52 g/mol. Its IUPAC name is [5-(N'-phenylmethoxycarbonylcarbamimidoyl)-1-benzofuran-2-yl] 2-cyclohexyloxy-2-formamidoacetate.
| Compound Name | [5-(N'-phenylmethoxycarbonylcarbamimidoyl)-1-benzofuran-2-yl] 2-cyclohexyloxy-2-formamidoacetate |
|---|---|
| PubChem CID | 173320191 |
| Molecular Formula | C26H27N3O7 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | [5-(N'-phenylmethoxycarbonylcarbamimidoyl)-1-benzofuran-2-yl] 2-cyclohexyloxy-2-formamidoacetate |
| SMILES | NC(=NC(=O)OCc1ccccc1)c1ccc2oc(OC(=O)C(NC=O)OC3CCCCC3)cc2c1 |
| InChI | InChI=1S/C26H27N3O7/c27-23(29-26(32)33-15-17-7-3-1-4-8-17)18-11-12-21-19(13-18)14-22(35-21)36-25(31)24(28-16-30)34-20-9-5-2-6-10-20/h1,3-4,7-8,11-14,16,20,24H,2,5-6,9-10,15H2,(H,28,30)(H2,27,29,32) |
| InChIKey | ONUBBOQYCYDQHU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|