C37H39ClN2O2 — CID 10769545
benzyl (1R,3S)-1-(1-adamantylmethyl)-9-[(2-chlorophenyl)methyl]-1,2,3,4-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 10769545) has the molecular formula C37H39ClN2O2 and a molecular weight of 579.18 g/mol. Its IUPAC name is benzyl (1R,3S)-1-(1-adamantylmethyl)-9-[(2-chlorophenyl)methyl]-1,2,3,4-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | benzyl (1R,3S)-1-(1-adamantylmethyl)-9-[(2-chlorophenyl)methyl]-1,2,3,4-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 10769545 |
| Molecular Formula | C37H39ClN2O2 |
| Molecular Weight | 579.18 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | benzyl (1R,3S)-1-(1-adamantylmethyl)-9-[(2-chlorophenyl)methyl]-1,2,3,4-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1Cc2c(n(Cc3ccccc3Cl)c3ccccc23)[C@@H](CC23CC4CC(CC(C4)C2)C3)N1 |
| InChI | InChI=1S/C37H39ClN2O2/c38-31-12-6-4-10-28(31)22-40-34-13-7-5-11-29(34)30-17-32(36(41)42-23-24-8-2-1-3-9-24)39-33(35(30)40)21-37-18-25-14-26(19-37)16-27(15-25)20-37/h1-13,25-27,32-33,39H,14-23H2/t25?,26?,27?,32-,33+,37?/m0/s1 |
| InChIKey | ISLYVSQCTGAGOE-ZUIVTHNISA-N |
| XLogP | 8.25 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.18 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|