C27H30N2O5 — CID 146167676
benzyl (1S,12R,15R)-3-(2-ethoxy-2-oxoethyl)-15-methoxy-3,13-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene-13-carboxylate (PubChem CID 146167676) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is benzyl (1S,12R,15R)-3-(2-ethoxy-2-oxoethyl)-15-methoxy-3,13-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene-13-carboxylate.
| Compound Name | benzyl (1S,12R,15R)-3-(2-ethoxy-2-oxoethyl)-15-methoxy-3,13-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene-13-carboxylate |
|---|---|
| PubChem CID | 146167676 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | benzyl (1S,12R,15R)-3-(2-ethoxy-2-oxoethyl)-15-methoxy-3,13-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene-13-carboxylate |
| SMILES | CCOC(=O)Cn1c2c(c3ccccc31)C[C@H]1C[C@@H]2[C@@H](OC)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H30N2O5/c1-3-33-25(30)16-29-23-12-8-7-11-20(23)21-13-19-14-22(26(21)29)24(32-2)15-28(19)27(31)34-17-18-9-5-4-6-10-18/h4-12,19,22,24H,3,13-17H2,1-2H3/t19-,22+,24-/m0/s1 |
| InChIKey | PUJBKYIPGZHWOB-KWOQKUFVSA-N |
| XLogP | 4.27 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |