C12H23NO5S — CID 107704635
2-[4-(6-hydroxyhexyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid (PubChem CID 107704635) has the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. Its IUPAC name is 2-[4-(6-hydroxyhexyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid.
| Compound Name | 2-[4-(6-hydroxyhexyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid |
|---|---|
| PubChem CID | 107704635 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-[4-(6-hydroxyhexyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid |
| SMILES | O=C(O)CC1CS(=O)(=O)CCN1CCCCCCO |
| InChI | InChI=1S/C12H23NO5S/c14-7-4-2-1-3-5-13-6-8-19(17,18)10-11(13)9-12(15)16/h11,14H,1-10H2,(H,15,16) |
| InChIKey | ZYSALTSZUXKDIK-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|