C10H15NO4S — CID 80519473
2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid (PubChem CID 80519473) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid.
| Compound Name | 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid |
|---|---|
| PubChem CID | 80519473 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid |
| SMILES | CC#CCN1CCS(=O)(=O)CC1CC(=O)O |
| InChI | InChI=1S/C10H15NO4S/c1-2-3-4-11-5-6-16(14,15)8-9(11)7-10(12)13/h9H,4-8H2,1H3,(H,12,13) |
| InChIKey | MUGJRIRTXJVTMU-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|