2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid

C10H15NO4S — CID 80519473

IUPAC2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid
SMILESCC#CCN1CCS(=O)(=O)CC1CC(=O)O
InChIInChI=1S/C10H15NO4S/c1-2-3-4-11-5-6-16(14,15)8-9(11)7-10(12)13/h9H,4-8H2,1H3,(H,12,13)
InChIKeyMUGJRIRTXJVTMU-UHFFFAOYSA-N
MW245.30 g/mol
LogP-0.42
Rot. Bonds3

About 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid

2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid (PubChem CID 80519473) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid.

Molecular Properties

Compound Name2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid
PubChem CID80519473
Molecular FormulaC10H15NO4S
Molecular Weight245.30 g/mol
Exact Mass245.07
IUPAC Name2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid
SMILESCC#CCN1CCS(=O)(=O)CC1CC(=O)O
InChIInChI=1S/C10H15NO4S/c1-2-3-4-11-5-6-16(14,15)8-9(11)7-10(12)13/h9H,4-8H2,1H3,(H,12,13)
InChIKeyMUGJRIRTXJVTMU-UHFFFAOYSA-N
XLogP-0.42
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.30
LogP ≤ 5-0.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid?
The IUPAC name of 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid (CID 80519473) is 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid.
What is the SMILES notation for 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid?
The canonical SMILES for 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid is CC#CCN1CCS(=O)(=O)CC1CC(=O)O.
What is the InChIKey of 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid?
The InChIKey is MUGJRIRTXJVTMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO4S/c1-2-3-4-11-5-6-16(14,15)8-9(11)7-10(12)13/h9H,4-8H2,1H3,(H,12,13).
What are the key properties of 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid?
2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid has a molecular weight of 245.30 g/mol, XLogP of -0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid is sourced from PubChem (CID 80519473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).