About 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid
2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid (PubChem CID 80519473) has the molecular formula C10H15NO4S
and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid |
| PubChem CID | 80519473 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid |
| SMILES | CC#CCN1CCS(=O)(=O)CC1CC(=O)O |
| InChI | InChI=1S/C10H15NO4S/c1-2-3-4-11-5-6-16(14,15)8-9(11)7-10(12)13/h9H,4-8H2,1H3,(H,12,13) |
| InChIKey | MUGJRIRTXJVTMU-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid?
The IUPAC name of 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid (CID 80519473) is 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid.
What is the SMILES notation for 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid?
The canonical SMILES for 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid is CC#CCN1CCS(=O)(=O)CC1CC(=O)O.
What is the InChIKey of 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid?
The InChIKey is MUGJRIRTXJVTMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO4S/c1-2-3-4-11-5-6-16(14,15)8-9(11)7-10(12)13/h9H,4-8H2,1H3,(H,12,13).
What are the key properties of 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid?
2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid has a molecular weight of 245.30 g/mol, XLogP of -0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-but-2-ynyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid is sourced from PubChem (CID 80519473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).