C15H23N3O3 — CID 107707648
1-[1-(3,5-dihydroxyphenyl)ethyl]-N-ethylpiperazine-2-carboxamide (PubChem CID 107707648) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-[1-(3,5-dihydroxyphenyl)ethyl]-N-ethylpiperazine-2-carboxamide.
| Compound Name | 1-[1-(3,5-dihydroxyphenyl)ethyl]-N-ethylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 107707648 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1-[1-(3,5-dihydroxyphenyl)ethyl]-N-ethylpiperazine-2-carboxamide |
| SMILES | CCNC(=O)C1CNCCN1C(C)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H23N3O3/c1-3-17-15(21)14-9-16-4-5-18(14)10(2)11-6-12(19)8-13(20)7-11/h6-8,10,14,16,19-20H,3-5,9H2,1-2H3,(H,17,21) |
| InChIKey | HMHIYKDNOFSMMB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |