C13H12N2O5 — CID 107728213
3-[(3,4-dihydroxybenzoyl)amino]-5-methyl-1H-pyrrole-2-carboxylic acid (PubChem CID 107728213) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 3-[(3,4-dihydroxybenzoyl)amino]-5-methyl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3-[(3,4-dihydroxybenzoyl)amino]-5-methyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 107728213 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-[(3,4-dihydroxybenzoyl)amino]-5-methyl-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1cc(NC(=O)c2ccc(O)c(O)c2)c(C(=O)O)[nH]1 |
| InChI | InChI=1S/C13H12N2O5/c1-6-4-8(11(14-6)13(19)20)15-12(18)7-2-3-9(16)10(17)5-7/h2-5,14,16-17H,1H3,(H,15,18)(H,19,20) |
| InChIKey | MZQLMJMUMPIMQK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|