C13H16F2O3S — CID 107767572
1-(2,4-difluorophenyl)-2-(3-methylbutan-2-ylsulfonyl)ethanone (PubChem CID 107767572) has the molecular formula C13H16F2O3S and a molecular weight of 290.33 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(3-methylbutan-2-ylsulfonyl)ethanone.
| Compound Name | 1-(2,4-difluorophenyl)-2-(3-methylbutan-2-ylsulfonyl)ethanone |
|---|---|
| PubChem CID | 107767572 |
| Molecular Formula | C13H16F2O3S |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(3-methylbutan-2-ylsulfonyl)ethanone |
| SMILES | CC(C)C(C)S(=O)(=O)CC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H16F2O3S/c1-8(2)9(3)19(17,18)7-13(16)11-5-4-10(14)6-12(11)15/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | PKEPIEIJGGXMDQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |