C14H18F2O — CID 55262244
1-(2,4-difluorophenyl)-3,4,4-trimethylpentan-1-one (PubChem CID 55262244) has the molecular formula C14H18F2O and a molecular weight of 240.29 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3,4,4-trimethylpentan-1-one.
| Compound Name | 1-(2,4-difluorophenyl)-3,4,4-trimethylpentan-1-one |
|---|---|
| PubChem CID | 55262244 |
| Molecular Formula | C14H18F2O |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3,4,4-trimethylpentan-1-one |
| SMILES | CC(CC(=O)c1ccc(F)cc1F)C(C)(C)C |
| InChI | InChI=1S/C14H18F2O/c1-9(14(2,3)4)7-13(17)11-6-5-10(15)8-12(11)16/h5-6,8-9H,7H2,1-4H3 |
| InChIKey | DVBVYWPMWUGEPG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |