C18H23NOS — CID 107772617
3-(2-amino-1,2-diphenylethyl)sulfanylbutan-2-ol (PubChem CID 107772617) has the molecular formula C18H23NOS and a molecular weight of 301.46 g/mol. Its IUPAC name is 3-(2-amino-1,2-diphenylethyl)sulfanylbutan-2-ol.
| Compound Name | 3-(2-amino-1,2-diphenylethyl)sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 107772617 |
| Molecular Formula | C18H23NOS |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 3-(2-amino-1,2-diphenylethyl)sulfanylbutan-2-ol |
| SMILES | CC(O)C(C)SC(c1ccccc1)C(N)c1ccccc1 |
| InChI | InChI=1S/C18H23NOS/c1-13(20)14(2)21-18(16-11-7-4-8-12-16)17(19)15-9-5-3-6-10-15/h3-14,17-18,20H,19H2,1-2H3 |
| InChIKey | FSXUHMGBJMSXON-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |