C16H23BrCl2N2 — CID 107794416
1-(4-bromo-2,3-dichlorophenyl)-2,5-di(propan-2-yl)piperazine (PubChem CID 107794416) has the molecular formula C16H23BrCl2N2 and a molecular weight of 394.18 g/mol. Its IUPAC name is 1-(4-bromo-2,3-dichlorophenyl)-2,5-di(propan-2-yl)piperazine.
| Compound Name | 1-(4-bromo-2,3-dichlorophenyl)-2,5-di(propan-2-yl)piperazine |
|---|---|
| PubChem CID | 107794416 |
| Molecular Formula | C16H23BrCl2N2 |
| Molecular Weight | 394.18 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 1-(4-bromo-2,3-dichlorophenyl)-2,5-di(propan-2-yl)piperazine |
| SMILES | CC(C)C1CN(c2ccc(Br)c(Cl)c2Cl)C(C(C)C)CN1 |
| InChI | InChI=1S/C16H23BrCl2N2/c1-9(2)12-8-21(14(7-20-12)10(3)4)13-6-5-11(17)15(18)16(13)19/h5-6,9-10,12,14,20H,7-8H2,1-4H3 |
| InChIKey | FKXHPYXWBORGJL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.18 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|