C15H29FO2Si — CID 10779745
[(4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-fluoroethyl)cyclohexen-1-yl]methanol (PubChem CID 10779745) has the molecular formula C15H29FO2Si and a molecular weight of 288.48 g/mol. Its IUPAC name is [(4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-fluoroethyl)cyclohexen-1-yl]methanol.
| Compound Name | [(4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-fluoroethyl)cyclohexen-1-yl]methanol |
|---|---|
| PubChem CID | 10779745 |
| Molecular Formula | C15H29FO2Si |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | [(4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-fluoroethyl)cyclohexen-1-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC=C(CO)[C@@H](CCF)C1 |
| InChI | InChI=1S/C15H29FO2Si/c1-15(2,3)19(4,5)18-14-7-6-13(11-17)12(10-14)8-9-16/h6,12,14,17H,7-11H2,1-5H3/t12-,14+/m0/s1 |
| InChIKey | FFCQMKIHFVHATR-GXTWGEPZSA-N |
| XLogP | 4.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|