C12H13NO6S — CID 10780475
(3S)-7-ethoxycarbonyl-2,2-dimethyl-5,6-dioxo-3H-pyrrolo[2,1-b][1,3]thiazole-3-carboxylic acid (PubChem CID 10780475) has the molecular formula C12H13NO6S and a molecular weight of 299.30 g/mol. Its IUPAC name is (3S)-7-ethoxycarbonyl-2,2-dimethyl-5,6-dioxo-3H-pyrrolo[2,1-b][1,3]thiazole-3-carboxylic acid.
| Compound Name | (3S)-7-ethoxycarbonyl-2,2-dimethyl-5,6-dioxo-3H-pyrrolo[2,1-b][1,3]thiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 10780475 |
| Molecular Formula | C12H13NO6S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (3S)-7-ethoxycarbonyl-2,2-dimethyl-5,6-dioxo-3H-pyrrolo[2,1-b][1,3]thiazole-3-carboxylic acid |
| SMILES | CCOC(=O)C1=C2SC(C)(C)[C@H](C(=O)O)N2C(=O)C1=O |
| InChI | InChI=1S/C12H13NO6S/c1-4-19-11(18)5-6(14)8(15)13-7(10(16)17)12(2,3)20-9(5)13/h7H,4H2,1-3H3,(H,16,17)/t7-/m0/s1 |
| InChIKey | QZONJANLLUHTQW-ZETCQYMHSA-N |
| XLogP | 0.15 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|