C13H13ClN2O2S — CID 107808771
3-chloro-4-(4-methyl-2,6-dioxopiperidin-1-yl)benzenecarbothioamide (PubChem CID 107808771) has the molecular formula C13H13ClN2O2S and a molecular weight of 296.78 g/mol. Its IUPAC name is 3-chloro-4-(4-methyl-2,6-dioxopiperidin-1-yl)benzenecarbothioamide.
| Compound Name | 3-chloro-4-(4-methyl-2,6-dioxopiperidin-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 107808771 |
| Molecular Formula | C13H13ClN2O2S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3-chloro-4-(4-methyl-2,6-dioxopiperidin-1-yl)benzenecarbothioamide |
| SMILES | CC1CC(=O)N(c2ccc(C(N)=S)cc2Cl)C(=O)C1 |
| InChI | InChI=1S/C13H13ClN2O2S/c1-7-4-11(17)16(12(18)5-7)10-3-2-8(13(15)19)6-9(10)14/h2-3,6-7H,4-5H2,1H3,(H2,15,19) |
| InChIKey | UDILPVBAZMSOQJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|