C19H33NO — CID 107817926
1-(2-ethylhexyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-ol (PubChem CID 107817926) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-ol.
| Compound Name | 1-(2-ethylhexyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-ol |
|---|---|
| PubChem CID | 107817926 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 1-(2-ethylhexyl)-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-ol |
| SMILES | CCCCC(CC)Cn1c(C)cc2c1CC(C)(C)CC2O |
| InChI | InChI=1S/C19H33NO/c1-6-8-9-15(7-2)13-20-14(3)10-16-17(20)11-19(4,5)12-18(16)21/h10,15,18,21H,6-9,11-13H2,1-5H3 |
| InChIKey | RRIWIFLGMRAICA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |